C19H18ClN2O3S+ — CID 19438722
ethyl 9-(2-chlorophenyl)-12-oxo-7-thia-11-aza-12-azoniatricyclo[6.5.0.02,6]trideca-1(8),2(6),9-triene-5-carboxylate (PubChem CID 19438722) has the molecular formula C19H18ClN2O3S+ and a molecular weight of 389.88 g/mol. Its IUPAC name is ethyl 9-(2-chlorophenyl)-12-oxo-7-thia-11-aza-12-azoniatricyclo[6.5.0.02,6]trideca-1(8),2(6),9-triene-5-carboxylate.
| Compound Name | ethyl 9-(2-chlorophenyl)-12-oxo-7-thia-11-aza-12-azoniatricyclo[6.5.0.02,6]trideca-1(8),2(6),9-triene-5-carboxylate |
|---|---|
| PubChem CID | 19438722 |
| Molecular Formula | C19H18ClN2O3S+ |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | ethyl 9-(2-chlorophenyl)-12-oxo-7-thia-11-aza-12-azoniatricyclo[6.5.0.02,6]trideca-1(8),2(6),9-triene-5-carboxylate |
| SMILES | CCOC(=O)C1CCc2c1sc1c2C[N+](=O)NC=C1c1ccccc1Cl |
| InChI | InChI=1S/C19H18ClN2O3S/c1-2-25-19(23)13-8-7-12-15-10-22(24)21-9-14(18(15)26-17(12)13)11-5-3-4-6-16(11)20/h3-6,9,13H,2,7-8,10H2,1H3,(H,21,24)/q+1 |
| InChIKey | XTBPDFQGFOGYIN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|