C14H16ClNO2 — CID 19438891
methyl 3-(4-chlorobutyl)-1H-indole-7-carboxylate (PubChem CID 19438891) has the molecular formula C14H16ClNO2 and a molecular weight of 265.74 g/mol. Its IUPAC name is methyl 3-(4-chlorobutyl)-1H-indole-7-carboxylate.
| Compound Name | methyl 3-(4-chlorobutyl)-1H-indole-7-carboxylate |
|---|---|
| PubChem CID | 19438891 |
| Molecular Formula | C14H16ClNO2 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | methyl 3-(4-chlorobutyl)-1H-indole-7-carboxylate |
| SMILES | COC(=O)c1cccc2c(CCCCCl)c[nH]c12 |
| InChI | InChI=1S/C14H16ClNO2/c1-18-14(17)12-7-4-6-11-10(5-2-3-8-15)9-16-13(11)12/h4,6-7,9,16H,2-3,5,8H2,1H3 |
| InChIKey | ZSMAUHHQPNQOTK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|