About N-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-fluoroaniline
N-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-fluoroaniline (PubChem CID 19439539) has the molecular formula C14H9F3N2S
and a molecular weight of 294.30 g/mol. Its IUPAC name is N-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-fluoroaniline.
Molecular Properties
| Compound Name | N-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-fluoroaniline |
| PubChem CID | 19439539 |
| Molecular Formula | C14H9F3N2S |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | N-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-fluoroaniline |
| SMILES | Fc1ccc(NCc2nc3ccc(F)c(F)c3s2)cc1 |
| InChI | InChI=1S/C14H9F3N2S/c15-8-1-3-9(4-2-8)18-7-12-19-11-6-5-10(16)13(17)14(11)20-12/h1-6,18H,7H2 |
| InChIKey | PCURAXHRVKHTCQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-fluoroaniline?
The IUPAC name of N-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-fluoroaniline (CID 19439539) is N-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-fluoroaniline.
What is the SMILES notation for N-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-fluoroaniline?
The canonical SMILES for N-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-fluoroaniline is Fc1ccc(NCc2nc3ccc(F)c(F)c3s2)cc1.
What is the InChIKey of N-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-fluoroaniline?
The InChIKey is PCURAXHRVKHTCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F3N2S/c15-8-1-3-9(4-2-8)18-7-12-19-11-6-5-10(16)13(17)14(11)20-12/h1-6,18H,7H2.
What are the key properties of N-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-fluoroaniline?
N-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-fluoroaniline has a molecular weight of 294.30 g/mol, XLogP of 4.33, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-fluoroaniline is sourced from PubChem (CID 19439539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).