C5H12N4OS — CID 19439671
[N'-(2-methoxyethyl)carbamimidoyl]thiourea (PubChem CID 19439671) has the molecular formula C5H12N4OS and a molecular weight of 176.25 g/mol. Its IUPAC name is [N'-(2-methoxyethyl)carbamimidoyl]thiourea.
| Compound Name | [N'-(2-methoxyethyl)carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 19439671 |
| Molecular Formula | C5H12N4OS |
| Molecular Weight | 176.25 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | [N'-(2-methoxyethyl)carbamimidoyl]thiourea |
| SMILES | COCC/N=C(\N)NC(N)=S |
| InChI | InChI=1S/C5H12N4OS/c1-10-3-2-8-4(6)9-5(7)11/h2-3H2,1H3,(H5,6,7,8,9,11) |
| InChIKey | YDVQOPMXPKPQIF-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.25 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|