C11H24N2 — CID 19439849
N,4-dimethyl-2-pyrrolidin-1-ylpentan-1-amine (PubChem CID 19439849) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is N,4-dimethyl-2-pyrrolidin-1-ylpentan-1-amine.
| Compound Name | N,4-dimethyl-2-pyrrolidin-1-ylpentan-1-amine |
|---|---|
| PubChem CID | 19439849 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | N,4-dimethyl-2-pyrrolidin-1-ylpentan-1-amine |
| SMILES | CNCC(CC(C)C)N1CCCC1 |
| InChI | InChI=1S/C11H24N2/c1-10(2)8-11(9-12-3)13-6-4-5-7-13/h10-12H,4-9H2,1-3H3 |
| InChIKey | JALAJNLLJGNFAJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |