C17H20N6O3S — CID 19445675
1-[1-methyl-5-(piperidine-1-carbonyl)pyrazol-4-yl]-3-(4-nitrophenyl)thiourea (PubChem CID 19445675) has the molecular formula C17H20N6O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is 1-[1-methyl-5-(piperidine-1-carbonyl)pyrazol-4-yl]-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-[1-methyl-5-(piperidine-1-carbonyl)pyrazol-4-yl]-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 19445675 |
| Molecular Formula | C17H20N6O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 1-[1-methyl-5-(piperidine-1-carbonyl)pyrazol-4-yl]-3-(4-nitrophenyl)thiourea |
| SMILES | Cn1ncc(NC(=S)Nc2ccc([N+](=O)[O-])cc2)c1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C17H20N6O3S/c1-21-15(16(24)22-9-3-2-4-10-22)14(11-18-21)20-17(27)19-12-5-7-13(8-6-12)23(25)26/h5-8,11H,2-4,9-10H2,1H3,(H2,19,20,27) |
| InChIKey | QNVUTMYAGHDHPN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|