C19H20IN3O3 — CID 19446050
N-[1-(1-ethylpyrazol-3-yl)ethyl]-5-[(4-iodophenoxy)methyl]furan-2-carboxamide (PubChem CID 19446050) has the molecular formula C19H20IN3O3 and a molecular weight of 465.29 g/mol. Its IUPAC name is N-[1-(1-ethylpyrazol-3-yl)ethyl]-5-[(4-iodophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[1-(1-ethylpyrazol-3-yl)ethyl]-5-[(4-iodophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19446050 |
| Molecular Formula | C19H20IN3O3 |
| Molecular Weight | 465.29 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | N-[1-(1-ethylpyrazol-3-yl)ethyl]-5-[(4-iodophenoxy)methyl]furan-2-carboxamide |
| SMILES | CCn1ccc(C(C)NC(=O)c2ccc(COc3ccc(I)cc3)o2)n1 |
| InChI | InChI=1S/C19H20IN3O3/c1-3-23-11-10-17(22-23)13(2)21-19(24)18-9-8-16(26-18)12-25-15-6-4-14(20)5-7-15/h4-11,13H,3,12H2,1-2H3,(H,21,24) |
| InChIKey | LWGLTPLSZLBPAK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|