C27H37F2N5O — CID 19447221
7-(difluoromethyl)-N-[1-(dipentylamino)propan-2-yl]-5-phenylpyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 19447221) has the molecular formula C27H37F2N5O and a molecular weight of 485.62 g/mol. Its IUPAC name is 7-(difluoromethyl)-N-[1-(dipentylamino)propan-2-yl]-5-phenylpyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 7-(difluoromethyl)-N-[1-(dipentylamino)propan-2-yl]-5-phenylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 19447221 |
| Molecular Formula | C27H37F2N5O |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | 7-(difluoromethyl)-N-[1-(dipentylamino)propan-2-yl]-5-phenylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CCCCCN(CCCCC)CC(C)NC(=O)c1cnn2c(C(F)F)cc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C27H37F2N5O/c1-4-6-11-15-33(16-12-7-5-2)19-20(3)31-27(35)22-18-30-34-24(25(28)29)17-23(32-26(22)34)21-13-9-8-10-14-21/h8-10,13-14,17-18,20,25H,4-7,11-12,15-16,19H2,1-3H3,(H,31,35) |
| InChIKey | DVHMSZXXAJEIFT-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|