C15H21F3N6OS — CID 19447629
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]thiourea (PubChem CID 19447629) has the molecular formula C15H21F3N6OS and a molecular weight of 390.44 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]thiourea.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19447629 |
| Molecular Formula | C15H21F3N6OS |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]thiourea |
| SMILES | Cc1cc(C)n(CCCNC(=S)Nc2cnn(COCC(F)(F)F)c2)n1 |
| InChI | InChI=1S/C15H21F3N6OS/c1-11-6-12(2)24(22-11)5-3-4-19-14(26)21-13-7-20-23(8-13)10-25-9-15(16,17)18/h6-8H,3-5,9-10H2,1-2H3,(H2,19,21,26) |
| InChIKey | BWVWXLDRQQFLGQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|