C17H18BrF2N3O2 — CID 19451953
(Z)-N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-3-[4-(difluoromethoxy)phenyl]-N-methylprop-2-enamide (PubChem CID 19451953) has the molecular formula C17H18BrF2N3O2 and a molecular weight of 414.25 g/mol. Its IUPAC name is (Z)-N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-3-[4-(difluoromethoxy)phenyl]-N-methylprop-2-enamide.
| Compound Name | (Z)-N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-3-[4-(difluoromethoxy)phenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 19451953 |
| Molecular Formula | C17H18BrF2N3O2 |
| Molecular Weight | 414.25 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | (Z)-N-[(4-bromo-1-ethylpyrazol-3-yl)methyl]-3-[4-(difluoromethoxy)phenyl]-N-methylprop-2-enamide |
| SMILES | CCn1cc(Br)c(CN(C)C(=O)/C=C\c2ccc(OC(F)F)cc2)n1 |
| InChI | InChI=1S/C17H18BrF2N3O2/c1-3-23-10-14(18)15(21-23)11-22(2)16(24)9-6-12-4-7-13(8-5-12)25-17(19)20/h4-10,17H,3,11H2,1-2H3/b9-6- |
| InChIKey | XHHILPNFXPZVRA-TWGQIWQCSA-N |
| XLogP | 3.94 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.25 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|