C21H22ClN3O2 — CID 19454276
3-[(4-chlorophenoxy)methyl]-N-[(2-ethylpyrazol-3-yl)methyl]-N-methylbenzamide (PubChem CID 19454276) has the molecular formula C21H22ClN3O2 and a molecular weight of 383.88 g/mol. Its IUPAC name is 3-[(4-chlorophenoxy)methyl]-N-[(2-ethylpyrazol-3-yl)methyl]-N-methylbenzamide.
| Compound Name | 3-[(4-chlorophenoxy)methyl]-N-[(2-ethylpyrazol-3-yl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 19454276 |
| Molecular Formula | C21H22ClN3O2 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 3-[(4-chlorophenoxy)methyl]-N-[(2-ethylpyrazol-3-yl)methyl]-N-methylbenzamide |
| SMILES | CCn1nccc1CN(C)C(=O)c1cccc(COc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H22ClN3O2/c1-3-25-19(11-12-23-25)14-24(2)21(26)17-6-4-5-16(13-17)15-27-20-9-7-18(22)8-10-20/h4-13H,3,14-15H2,1-2H3 |
| InChIKey | HZLIMUIHLKVLSP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |