C19H19F3N4OS — CID 19457724
5-(4-propan-2-ylphenyl)-N-(2-sulfanylethyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 19457724) has the molecular formula C19H19F3N4OS and a molecular weight of 408.45 g/mol. Its IUPAC name is 5-(4-propan-2-ylphenyl)-N-(2-sulfanylethyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 5-(4-propan-2-ylphenyl)-N-(2-sulfanylethyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 19457724 |
| Molecular Formula | C19H19F3N4OS |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 5-(4-propan-2-ylphenyl)-N-(2-sulfanylethyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CC(C)c1ccc(-c2cc(C(F)(F)F)n3ncc(C(=O)NCCS)c3n2)cc1 |
| InChI | InChI=1S/C19H19F3N4OS/c1-11(2)12-3-5-13(6-4-12)15-9-16(19(20,21)22)26-17(25-15)14(10-24-26)18(27)23-7-8-28/h3-6,9-11,28H,7-8H2,1-2H3,(H,23,27) |
| InChIKey | JFXARKSWTKJRLK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|