C14H15ClF2N4O2 — CID 19457924
7-[chloro(difluoro)methyl]-5-methyl-N-(oxolan-2-ylmethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19457924) has the molecular formula C14H15ClF2N4O2 and a molecular weight of 344.75 g/mol. Its IUPAC name is 7-[chloro(difluoro)methyl]-5-methyl-N-(oxolan-2-ylmethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 7-[chloro(difluoro)methyl]-5-methyl-N-(oxolan-2-ylmethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19457924 |
| Molecular Formula | C14H15ClF2N4O2 |
| Molecular Weight | 344.75 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 7-[chloro(difluoro)methyl]-5-methyl-N-(oxolan-2-ylmethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1cc(C(F)(F)Cl)n2nc(C(=O)NCC3CCCO3)cc2n1 |
| InChI | InChI=1S/C14H15ClF2N4O2/c1-8-5-11(14(15,16)17)21-12(19-8)6-10(20-21)13(22)18-7-9-3-2-4-23-9/h5-6,9H,2-4,7H2,1H3,(H,18,22) |
| InChIKey | JPTGAMDFIRXYIU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.75 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|