C19H13Cl2F2NO4 — CID 19458716
N-[3-chloro-4-(difluoromethoxy)phenyl]-5-[(2-chlorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19458716) has the molecular formula C19H13Cl2F2NO4 and a molecular weight of 428.22 g/mol. Its IUPAC name is N-[3-chloro-4-(difluoromethoxy)phenyl]-5-[(2-chlorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[3-chloro-4-(difluoromethoxy)phenyl]-5-[(2-chlorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19458716 |
| Molecular Formula | C19H13Cl2F2NO4 |
| Molecular Weight | 428.22 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | N-[3-chloro-4-(difluoromethoxy)phenyl]-5-[(2-chlorophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)F)c(Cl)c1)c1ccc(COc2ccccc2Cl)o1 |
| InChI | InChI=1S/C19H13Cl2F2NO4/c20-13-3-1-2-4-15(13)26-10-12-6-8-17(27-12)18(25)24-11-5-7-16(14(21)9-11)28-19(22)23/h1-9,19H,10H2,(H,24,25) |
| InChIKey | NFVIRQFEYFLHJJ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.22 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |