C25H26N2O7S — CID 19461603
propyl 2-[[5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19461603) has the molecular formula C25H26N2O7S and a molecular weight of 498.56 g/mol. Its IUPAC name is propyl 2-[[5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | propyl 2-[[5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19461603 |
| Molecular Formula | C25H26N2O7S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | propyl 2-[[5-[(3-methyl-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCCOC(=O)c1c(NC(=O)c2ccc(COc3ccc([N+](=O)[O-])c(C)c3)o2)sc2c1CCCC2 |
| InChI | InChI=1S/C25H26N2O7S/c1-3-12-32-25(29)22-18-6-4-5-7-21(18)35-24(22)26-23(28)20-11-9-17(34-20)14-33-16-8-10-19(27(30)31)15(2)13-16/h8-11,13H,3-7,12,14H2,1-2H3,(H,26,28) |
| InChIKey | PUANHMUHGIBATQ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|