About 2,4-dimethylfuran
2,4-dimethylfuran (PubChem CID 19462) has the molecular formula C6H8O
and a molecular weight of 96.13 g/mol. Its IUPAC name is 2,4-dimethylfuran.
Molecular Properties
| Compound Name | 2,4-dimethylfuran |
| PubChem CID | 19462 |
| Molecular Formula | C6H8O |
| Molecular Weight | 96.13 g/mol |
| Exact Mass | 96.06 |
| IUPAC Name | 2,4-dimethylfuran |
| SMILES | Cc1coc(C)c1 |
| InChI | InChI=1S/C6H8O/c1-5-3-6(2)7-4-5/h3-4H,1-2H3 |
| InChIKey | AABTWRKUKUPMJG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.13 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-dimethylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylfuran?
The IUPAC name of 2,4-dimethylfuran (CID 19462) is 2,4-dimethylfuran.
What is the SMILES notation for 2,4-dimethylfuran?
The canonical SMILES for 2,4-dimethylfuran is Cc1coc(C)c1.
What is the InChIKey of 2,4-dimethylfuran?
The InChIKey is AABTWRKUKUPMJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O/c1-5-3-6(2)7-4-5/h3-4H,1-2H3.
What are the key properties of 2,4-dimethylfuran?
2,4-dimethylfuran has a molecular weight of 96.13 g/mol, XLogP of 1.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylfuran is sourced from PubChem (CID 19462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).