C12H14F7N3O — CID 19462908
N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 19462908) has the molecular formula C12H14F7N3O and a molecular weight of 349.25 g/mol. Its IUPAC name is N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 19462908 |
| Molecular Formula | C12H14F7N3O |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | CCn1cc(C(C)NC(=O)C(F)(F)C(F)(F)C(F)(F)F)c(C)n1 |
| InChI | InChI=1S/C12H14F7N3O/c1-4-22-5-8(7(3)21-22)6(2)20-9(23)10(13,14)11(15,16)12(17,18)19/h5-6H,4H2,1-3H3,(H,20,23) |
| InChIKey | GYEOPXHENOCGIX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|