C27H20ClF3N6O6S — CID 19463656
3-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-4-(1-ethyl-5-methylpyrazol-4-yl)-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19463656) has the molecular formula C27H20ClF3N6O6S and a molecular weight of 649.01 g/mol. Its IUPAC name is 3-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-4-(1-ethyl-5-methylpyrazol-4-yl)-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-4-(1-ethyl-5-methylpyrazol-4-yl)-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19463656 |
| Molecular Formula | C27H20ClF3N6O6S |
| Molecular Weight | 649.01 g/mol |
| Exact Mass | 648.08 |
| IUPAC Name | 3-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-4-(1-ethyl-5-methylpyrazol-4-yl)-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CCn1ncc(-c2cc(C(F)(F)F)nc3sc(C(N)=O)c(NC(=O)c4ccc(COc5ccc([N+](=O)[O-])cc5Cl)o4)c23)c1C |
| InChI | InChI=1S/C27H20ClF3N6O6S/c1-3-36-12(2)16(10-33-36)15-9-20(27(29,30)31)34-26-21(15)22(23(44-26)24(32)38)35-25(39)19-7-5-14(43-19)11-42-18-6-4-13(37(40)41)8-17(18)28/h4-10H,3,11H2,1-2H3,(H2,32,38)(H,35,39) |
| InChIKey | GOLNHUKHTZGMCD-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 168.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.01 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|