C19H18ClF3N4O2 — CID 19464528
N-butyl-3-chloro-5-(3-methoxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19464528) has the molecular formula C19H18ClF3N4O2 and a molecular weight of 426.83 g/mol. Its IUPAC name is N-butyl-3-chloro-5-(3-methoxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-butyl-3-chloro-5-(3-methoxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19464528 |
| Molecular Formula | C19H18ClF3N4O2 |
| Molecular Weight | 426.83 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | N-butyl-3-chloro-5-(3-methoxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CCCCNC(=O)c1nn2c(C(F)(F)F)cc(-c3cccc(OC)c3)nc2c1Cl |
| InChI | InChI=1S/C19H18ClF3N4O2/c1-3-4-8-24-18(28)16-15(20)17-25-13(11-6-5-7-12(9-11)29-2)10-14(19(21,22)23)27(17)26-16/h5-7,9-10H,3-4,8H2,1-2H3,(H,24,28) |
| InChIKey | DWIPNEOZRBWJCF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.83 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|