C18H23NO2S — CID 19471741
N-butyl-4-[(2,5-dimethylphenoxy)methyl]thiophene-2-carboxamide (PubChem CID 19471741) has the molecular formula C18H23NO2S and a molecular weight of 317.45 g/mol. Its IUPAC name is N-butyl-4-[(2,5-dimethylphenoxy)methyl]thiophene-2-carboxamide.
| Compound Name | N-butyl-4-[(2,5-dimethylphenoxy)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19471741 |
| Molecular Formula | C18H23NO2S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-butyl-4-[(2,5-dimethylphenoxy)methyl]thiophene-2-carboxamide |
| SMILES | CCCCNC(=O)c1cc(COc2cc(C)ccc2C)cs1 |
| InChI | InChI=1S/C18H23NO2S/c1-4-5-8-19-18(20)17-10-15(12-22-17)11-21-16-9-13(2)6-7-14(16)3/h6-7,9-10,12H,4-5,8,11H2,1-3H3,(H,19,20) |
| InChIKey | FVBSLNVVCKXTAC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|