C11H19N3O — CID 19472103
1-ethyl-3,5-dimethyl-N-propylpyrazole-4-carboxamide (PubChem CID 19472103) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-ethyl-3,5-dimethyl-N-propylpyrazole-4-carboxamide.
| Compound Name | 1-ethyl-3,5-dimethyl-N-propylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19472103 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 1-ethyl-3,5-dimethyl-N-propylpyrazole-4-carboxamide |
| SMILES | CCCNC(=O)c1c(C)nn(CC)c1C |
| InChI | InChI=1S/C11H19N3O/c1-5-7-12-11(15)10-8(3)13-14(6-2)9(10)4/h5-7H2,1-4H3,(H,12,15) |
| InChIKey | ADBPJRUONDTLAN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |