C34H34N4O4 — CID 19473746
3-(1-adamantyl)-N-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 19473746) has the molecular formula C34H34N4O4 and a molecular weight of 562.67 g/mol. Its IUPAC name is 3-(1-adamantyl)-N-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3-(1-adamantyl)-N-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19473746 |
| Molecular Formula | C34H34N4O4 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | 3-(1-adamantyl)-N-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1ccc(C)c(Oc2cc(NC(=O)c3cn(-c4ccccc4)nc3C34CC5CC(CC(C5)C3)C4)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C34H34N4O4/c1-21-8-9-22(2)31(10-21)42-29-15-26(14-28(16-29)38(40)41)35-33(39)30-20-37(27-6-4-3-5-7-27)36-32(30)34-17-23-11-24(18-34)13-25(12-23)19-34/h3-10,14-16,20,23-25H,11-13,17-19H2,1-2H3,(H,35,39) |
| InChIKey | OYSNAHOSZTWSPI-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|