C20H18F2N8O4S — CID 19478530
6-(difluoromethyl)-4-(1-ethyl-5-methylpyrazol-4-yl)-3-[(1-methyl-4-nitropyrazole-5-carbonyl)amino]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19478530) has the molecular formula C20H18F2N8O4S and a molecular weight of 504.48 g/mol. Its IUPAC name is 6-(difluoromethyl)-4-(1-ethyl-5-methylpyrazol-4-yl)-3-[(1-methyl-4-nitropyrazole-5-carbonyl)amino]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 6-(difluoromethyl)-4-(1-ethyl-5-methylpyrazol-4-yl)-3-[(1-methyl-4-nitropyrazole-5-carbonyl)amino]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19478530 |
| Molecular Formula | C20H18F2N8O4S |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | 6-(difluoromethyl)-4-(1-ethyl-5-methylpyrazol-4-yl)-3-[(1-methyl-4-nitropyrazole-5-carbonyl)amino]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CCn1ncc(-c2cc(C(F)F)nc3sc(C(N)=O)c(NC(=O)c4c([N+](=O)[O-])cnn4C)c23)c1C |
| InChI | InChI=1S/C20H18F2N8O4S/c1-4-29-8(2)10(6-25-29)9-5-11(17(21)22)26-20-13(9)14(16(35-20)18(23)31)27-19(32)15-12(30(33)34)7-24-28(15)3/h5-7,17H,4H2,1-3H3,(H2,23,31)(H,27,32) |
| InChIKey | VULUQHXWJFDRNL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 163.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|