About N-ethyladamantan-1-amine;hydrochloride
N-ethyladamantan-1-amine;hydrochloride (PubChem CID 19479) has the molecular formula C12H22ClN
and a molecular weight of 215.77 g/mol. Its IUPAC name is N-ethyladamantan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | N-ethyladamantan-1-amine;hydrochloride |
| PubChem CID | 19479 |
| Molecular Formula | C12H22ClN |
| Molecular Weight | 215.77 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | N-ethyladamantan-1-amine;hydrochloride |
| SMILES | CCNC12CC3CC(CC(C3)C1)C2.Cl |
| InChI | InChI=1S/C12H21N.ClH/c1-2-13-12-6-9-3-10(7-12)5-11(4-9)8-12;/h9-11,13H,2-8H2,1H3;1H |
| InChIKey | QBPTZTSMOGAMPF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.77 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyladamantan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyladamantan-1-amine;hydrochloride?
The IUPAC name of N-ethyladamantan-1-amine;hydrochloride (CID 19479) is N-ethyladamantan-1-amine;hydrochloride.
What is the SMILES notation for N-ethyladamantan-1-amine;hydrochloride?
The canonical SMILES for N-ethyladamantan-1-amine;hydrochloride is CCNC12CC3CC(CC(C3)C1)C2.Cl.
What is the InChIKey of N-ethyladamantan-1-amine;hydrochloride?
The InChIKey is QBPTZTSMOGAMPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N.ClH/c1-2-13-12-6-9-3-10(7-12)5-11(4-9)8-12;/h9-11,13H,2-8H2,1H3;1H.
What are the key properties of N-ethyladamantan-1-amine;hydrochloride?
N-ethyladamantan-1-amine;hydrochloride has a molecular weight of 215.77 g/mol, XLogP of 2.99, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyladamantan-1-amine;hydrochloride is sourced from PubChem (CID 19479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).