About N-ethyladamantan-1-amine
N-ethyladamantan-1-amine (PubChem CID 19480) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is N-ethyladamantan-1-amine.
Molecular Properties
| Compound Name | N-ethyladamantan-1-amine |
| PubChem CID | 19480 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | N-ethyladamantan-1-amine |
| SMILES | CCNC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C12H21N/c1-2-13-12-6-9-3-10(7-12)5-11(4-9)8-12/h9-11,13H,2-8H2,1H3 |
| InChIKey | VXGGWVBRICYCGO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyladamantan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyladamantan-1-amine?
The IUPAC name of N-ethyladamantan-1-amine (CID 19480) is N-ethyladamantan-1-amine.
What is the SMILES notation for N-ethyladamantan-1-amine?
The canonical SMILES for N-ethyladamantan-1-amine is CCNC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of N-ethyladamantan-1-amine?
The InChIKey is VXGGWVBRICYCGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N/c1-2-13-12-6-9-3-10(7-12)5-11(4-9)8-12/h9-11,13H,2-8H2,1H3.
What are the key properties of N-ethyladamantan-1-amine?
N-ethyladamantan-1-amine has a molecular weight of 179.31 g/mol, XLogP of 2.56, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyladamantan-1-amine is sourced from PubChem (CID 19480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).