C13H16F3N5O — CID 19480219
1-methyl-N-[3-(5-methylpyrazol-1-yl)propyl]-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 19480219) has the molecular formula C13H16F3N5O and a molecular weight of 315.30 g/mol. Its IUPAC name is 1-methyl-N-[3-(5-methylpyrazol-1-yl)propyl]-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 1-methyl-N-[3-(5-methylpyrazol-1-yl)propyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19480219 |
| Molecular Formula | C13H16F3N5O |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 1-methyl-N-[3-(5-methylpyrazol-1-yl)propyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | Cc1ccnn1CCCNC(=O)c1cc(C(F)(F)F)nn1C |
| InChI | InChI=1S/C13H16F3N5O/c1-9-4-6-18-21(9)7-3-5-17-12(22)10-8-11(13(14,15)16)19-20(10)2/h4,6,8H,3,5,7H2,1-2H3,(H,17,22) |
| InChIKey | IQXYUUBDAGCXMH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|