C12H11BrN4O4 — CID 19480601
4-bromo-N-(2-hydroxy-4-nitrophenyl)-1,3-dimethylpyrazole-5-carboxamide (PubChem CID 19480601) has the molecular formula C12H11BrN4O4 and a molecular weight of 355.15 g/mol. Its IUPAC name is 4-bromo-N-(2-hydroxy-4-nitrophenyl)-1,3-dimethylpyrazole-5-carboxamide.
| Compound Name | 4-bromo-N-(2-hydroxy-4-nitrophenyl)-1,3-dimethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19480601 |
| Molecular Formula | C12H11BrN4O4 |
| Molecular Weight | 355.15 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 4-bromo-N-(2-hydroxy-4-nitrophenyl)-1,3-dimethylpyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c(C(=O)Nc2ccc([N+](=O)[O-])cc2O)c1Br |
| InChI | InChI=1S/C12H11BrN4O4/c1-6-10(13)11(16(2)15-6)12(19)14-8-4-3-7(17(20)21)5-9(8)18/h3-5,18H,1-2H3,(H,14,19) |
| InChIKey | FZBABBPMJIAOGI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.15 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|