C13H15N3O2 — CID 19481236
N-(3-methoxyphenyl)-2,5-dimethylpyrazole-3-carboxamide (PubChem CID 19481236) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2,5-dimethylpyrazole-3-carboxamide.
| Compound Name | N-(3-methoxyphenyl)-2,5-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19481236 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-(3-methoxyphenyl)-2,5-dimethylpyrazole-3-carboxamide |
| SMILES | COc1cccc(NC(=O)c2cc(C)nn2C)c1 |
| InChI | InChI=1S/C13H15N3O2/c1-9-7-12(16(2)15-9)13(17)14-10-5-4-6-11(8-10)18-3/h4-8H,1-3H3,(H,14,17) |
| InChIKey | PDGTUHFSQZPGJH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |