C27H23N5O5 — CID 19482184
N-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]-2-[4-(furan-2-yl)-3-methylpyrazolo[3,4-b]pyridin-1-yl]acetamide (PubChem CID 19482184) has the molecular formula C27H23N5O5 and a molecular weight of 497.51 g/mol. Its IUPAC name is N-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]-2-[4-(furan-2-yl)-3-methylpyrazolo[3,4-b]pyridin-1-yl]acetamide.
| Compound Name | N-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]-2-[4-(furan-2-yl)-3-methylpyrazolo[3,4-b]pyridin-1-yl]acetamide |
|---|---|
| PubChem CID | 19482184 |
| Molecular Formula | C27H23N5O5 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | N-[3-(2,5-dimethylphenoxy)-5-nitrophenyl]-2-[4-(furan-2-yl)-3-methylpyrazolo[3,4-b]pyridin-1-yl]acetamide |
| SMILES | Cc1ccc(C)c(Oc2cc(NC(=O)Cn3nc(C)c4c(-c5ccco5)ccnc43)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C27H23N5O5/c1-16-6-7-17(2)24(11-16)37-21-13-19(12-20(14-21)32(34)35)29-25(33)15-31-27-26(18(3)30-31)22(8-9-28-27)23-5-4-10-36-23/h4-14H,15H2,1-3H3,(H,29,33) |
| InChIKey | XGFHOJYPWZHZMM-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|