C26H19F5N6O — CID 19487169
2-[3-methyl-4-(4-methylphenyl)pyrazolo[3,4-b]pyridin-1-yl]-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]acetamide (PubChem CID 19487169) has the molecular formula C26H19F5N6O and a molecular weight of 526.47 g/mol. Its IUPAC name is 2-[3-methyl-4-(4-methylphenyl)pyrazolo[3,4-b]pyridin-1-yl]-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]acetamide.
| Compound Name | 2-[3-methyl-4-(4-methylphenyl)pyrazolo[3,4-b]pyridin-1-yl]-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 19487169 |
| Molecular Formula | C26H19F5N6O |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | 2-[3-methyl-4-(4-methylphenyl)pyrazolo[3,4-b]pyridin-1-yl]-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]acetamide |
| SMILES | Cc1ccc(-c2ccnc3c2c(C)nn3CC(=O)Nc2cnn(Cc3c(F)c(F)c(F)c(F)c3F)c2)cc1 |
| InChI | InChI=1S/C26H19F5N6O/c1-13-3-5-15(6-4-13)17-7-8-32-26-20(17)14(2)35-37(26)12-19(38)34-16-9-33-36(10-16)11-18-21(27)23(29)25(31)24(30)22(18)28/h3-10H,11-12H2,1-2H3,(H,34,38) |
| InChIKey | JTJUSYVBEFQVAR-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|