C20H25N5O — CID 19489239
N-[3-(dimethylamino)propyl]-2-(3-methyl-4-phenylpyrazolo[3,4-b]pyridin-1-yl)acetamide (PubChem CID 19489239) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-(3-methyl-4-phenylpyrazolo[3,4-b]pyridin-1-yl)acetamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-(3-methyl-4-phenylpyrazolo[3,4-b]pyridin-1-yl)acetamide |
|---|---|
| PubChem CID | 19489239 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-(3-methyl-4-phenylpyrazolo[3,4-b]pyridin-1-yl)acetamide |
| SMILES | Cc1nn(CC(=O)NCCCN(C)C)c2nccc(-c3ccccc3)c12 |
| InChI | InChI=1S/C20H25N5O/c1-15-19-17(16-8-5-4-6-9-16)10-12-22-20(19)25(23-15)14-18(26)21-11-7-13-24(2)3/h4-6,8-10,12H,7,11,13-14H2,1-3H3,(H,21,26) |
| InChIKey | BGZCBYYONUVHKB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|