C22H19N3O2S — CID 19490888
N-(1-benzylpyrazol-4-yl)-4-(phenoxymethyl)thiophene-2-carboxamide (PubChem CID 19490888) has the molecular formula C22H19N3O2S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-(1-benzylpyrazol-4-yl)-4-(phenoxymethyl)thiophene-2-carboxamide.
| Compound Name | N-(1-benzylpyrazol-4-yl)-4-(phenoxymethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19490888 |
| Molecular Formula | C22H19N3O2S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-(1-benzylpyrazol-4-yl)-4-(phenoxymethyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1cnn(Cc2ccccc2)c1)c1cc(COc2ccccc2)cs1 |
| InChI | InChI=1S/C22H19N3O2S/c26-22(21-11-18(16-28-21)15-27-20-9-5-2-6-10-20)24-19-12-23-25(14-19)13-17-7-3-1-4-8-17/h1-12,14,16H,13,15H2,(H,24,26) |
| InChIKey | CQSUKKUNXCXXFZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |