C24H21FN2O2 — CID 19493503
N,N-dibenzyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 19493503) has the molecular formula C24H21FN2O2 and a molecular weight of 388.44 g/mol. Its IUPAC name is N,N-dibenzyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | N,N-dibenzyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 19493503 |
| Molecular Formula | C24H21FN2O2 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N,N-dibenzyl-3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | O=C(C1CC(c2ccc(F)cc2)=NO1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H21FN2O2/c25-21-13-11-20(12-14-21)22-15-23(29-26-22)24(28)27(16-18-7-3-1-4-8-18)17-19-9-5-2-6-10-19/h1-14,23H,15-17H2 |
| InChIKey | RLTUUJAUKIOZRM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |