C17H20N4O5S — CID 19496382
1-methyl-4-[4-(4-methylphenyl)sulfonylpiperazine-1-carbonyl]pyrazole-5-carboxylic acid (PubChem CID 19496382) has the molecular formula C17H20N4O5S and a molecular weight of 392.44 g/mol. Its IUPAC name is 1-methyl-4-[4-(4-methylphenyl)sulfonylpiperazine-1-carbonyl]pyrazole-5-carboxylic acid.
| Compound Name | 1-methyl-4-[4-(4-methylphenyl)sulfonylpiperazine-1-carbonyl]pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 19496382 |
| Molecular Formula | C17H20N4O5S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 1-methyl-4-[4-(4-methylphenyl)sulfonylpiperazine-1-carbonyl]pyrazole-5-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)c3cnn(C)c3C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C17H20N4O5S/c1-12-3-5-13(6-4-12)27(25,26)21-9-7-20(8-10-21)16(22)14-11-18-19(2)15(14)17(23)24/h3-6,11H,7-10H2,1-2H3,(H,23,24) |
| InChIKey | WTGKPMUJKFEHPL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |