C16H11F4N3OS — CID 19496827
N-(3-fluorophenyl)-4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]thiophene-2-carboxamide (PubChem CID 19496827) has the molecular formula C16H11F4N3OS and a molecular weight of 369.34 g/mol. Its IUPAC name is N-(3-fluorophenyl)-4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]thiophene-2-carboxamide.
| Compound Name | N-(3-fluorophenyl)-4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19496827 |
| Molecular Formula | C16H11F4N3OS |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | N-(3-fluorophenyl)-4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)c1cc(Cn2ccc(C(F)(F)F)n2)cs1 |
| InChI | InChI=1S/C16H11F4N3OS/c17-11-2-1-3-12(7-11)21-15(24)13-6-10(9-25-13)8-23-5-4-14(22-23)16(18,19)20/h1-7,9H,8H2,(H,21,24) |
| InChIKey | OACMIBCFEDIVRR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |