About 2-methylsulfanylbenzoic acid
2-methylsulfanylbenzoic acid (PubChem CID 19498) has the molecular formula C8H8O2S
and a molecular weight of 168.22 g/mol. Its IUPAC name is 2-methylsulfanylbenzoic acid.
Molecular Properties
| Compound Name | 2-methylsulfanylbenzoic acid |
| PubChem CID | 19498 |
| Molecular Formula | C8H8O2S |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 2-methylsulfanylbenzoic acid |
| SMILES | CSc1ccccc1C(=O)O |
| InChI | InChI=1S/C8H8O2S/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5H,1H3,(H,9,10) |
| InChIKey | LWJQGKJCZOGGPJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylsulfanylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanylbenzoic acid?
The IUPAC name of 2-methylsulfanylbenzoic acid (CID 19498) is 2-methylsulfanylbenzoic acid.
What is the SMILES notation for 2-methylsulfanylbenzoic acid?
The canonical SMILES for 2-methylsulfanylbenzoic acid is CSc1ccccc1C(=O)O.
What is the InChIKey of 2-methylsulfanylbenzoic acid?
The InChIKey is LWJQGKJCZOGGPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2S/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5H,1H3,(H,9,10).
What are the key properties of 2-methylsulfanylbenzoic acid?
2-methylsulfanylbenzoic acid has a molecular weight of 168.22 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanylbenzoic acid is sourced from PubChem (CID 19498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).