C17H11F3N8O2S — CID 19498099
11-methyl-4-[2-(4-nitropyrazol-1-yl)ethyl]-13-(trifluoromethyl)-16-thia-3,5,6,8,14-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10(15),11,13-heptaene (PubChem CID 19498099) has the molecular formula C17H11F3N8O2S and a molecular weight of 448.39 g/mol. Its IUPAC name is 11-methyl-4-[2-(4-nitropyrazol-1-yl)ethyl]-13-(trifluoromethyl)-16-thia-3,5,6,8,14-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10(15),11,13-heptaene.
| Compound Name | 11-methyl-4-[2-(4-nitropyrazol-1-yl)ethyl]-13-(trifluoromethyl)-16-thia-3,5,6,8,14-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10(15),11,13-heptaene |
|---|---|
| PubChem CID | 19498099 |
| Molecular Formula | C17H11F3N8O2S |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 11-methyl-4-[2-(4-nitropyrazol-1-yl)ethyl]-13-(trifluoromethyl)-16-thia-3,5,6,8,14-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10(15),11,13-heptaene |
| SMILES | Cc1cc(C(F)(F)F)nc2sc3c(ncn4nc(CCn5cc([N+](=O)[O-])cn5)nc34)c12 |
| InChI | InChI=1S/C17H11F3N8O2S/c1-8-4-10(17(18,19)20)23-16-12(8)13-14(31-16)15-24-11(25-27(15)7-21-13)2-3-26-6-9(5-22-26)28(29)30/h4-7H,2-3H2,1H3 |
| InChIKey | RJWKYLRGFJAVCN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 116.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|