C22H21N3O2S — CID 19499079
N-(1-ethyl-5-methylpyrazol-4-yl)-4-(naphthalen-2-yloxymethyl)thiophene-2-carboxamide (PubChem CID 19499079) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is N-(1-ethyl-5-methylpyrazol-4-yl)-4-(naphthalen-2-yloxymethyl)thiophene-2-carboxamide.
| Compound Name | N-(1-ethyl-5-methylpyrazol-4-yl)-4-(naphthalen-2-yloxymethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19499079 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | N-(1-ethyl-5-methylpyrazol-4-yl)-4-(naphthalen-2-yloxymethyl)thiophene-2-carboxamide |
| SMILES | CCn1ncc(NC(=O)c2cc(COc3ccc4ccccc4c3)cs2)c1C |
| InChI | InChI=1S/C22H21N3O2S/c1-3-25-15(2)20(12-23-25)24-22(26)21-10-16(14-28-21)13-27-19-9-8-17-6-4-5-7-18(17)11-19/h4-12,14H,3,13H2,1-2H3,(H,24,26) |
| InChIKey | KHUHRMIMHICSQY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |