C22H20N2O4S — CID 19500836
(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-[4-[(4-nitrophenoxy)methyl]thiophen-2-yl]methanone (PubChem CID 19500836) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-[4-[(4-nitrophenoxy)methyl]thiophen-2-yl]methanone.
| Compound Name | (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-[4-[(4-nitrophenoxy)methyl]thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 19500836 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | (6-methyl-3,4-dihydro-2H-quinolin-1-yl)-[4-[(4-nitrophenoxy)methyl]thiophen-2-yl]methanone |
| SMILES | Cc1ccc2c(c1)CCCN2C(=O)c1cc(COc2ccc([N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C22H20N2O4S/c1-15-4-9-20-17(11-15)3-2-10-23(20)22(25)21-12-16(14-29-21)13-28-19-7-5-18(6-8-19)24(26)27/h4-9,11-12,14H,2-3,10,13H2,1H3 |
| InChIKey | VEWSJOYACYODTQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|