C22H16ClF2N5O3 — CID 19501661
N-(2-chloro-4-nitrophenyl)-2-[4-(difluoromethyl)-3-methyl-6-phenylpyrazolo[5,4-b]pyridin-1-yl]acetamide (PubChem CID 19501661) has the molecular formula C22H16ClF2N5O3 and a molecular weight of 471.85 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-2-[4-(difluoromethyl)-3-methyl-6-phenylpyrazolo[5,4-b]pyridin-1-yl]acetamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-2-[4-(difluoromethyl)-3-methyl-6-phenylpyrazolo[5,4-b]pyridin-1-yl]acetamide |
|---|---|
| PubChem CID | 19501661 |
| Molecular Formula | C22H16ClF2N5O3 |
| Molecular Weight | 471.85 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-2-[4-(difluoromethyl)-3-methyl-6-phenylpyrazolo[5,4-b]pyridin-1-yl]acetamide |
| SMILES | Cc1nn(CC(=O)Nc2ccc([N+](=O)[O-])cc2Cl)c2nc(-c3ccccc3)cc(C(F)F)c12 |
| InChI | InChI=1S/C22H16ClF2N5O3/c1-12-20-15(21(24)25)10-18(13-5-3-2-4-6-13)27-22(20)29(28-12)11-19(31)26-17-8-7-14(30(32)33)9-16(17)23/h2-10,21H,11H2,1H3,(H,26,31) |
| InChIKey | SYUPZEITDVKRPD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.85 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|