C20H16ClNO3S — CID 19505153
N-(4-acetylphenyl)-4-[(3-chlorophenoxy)methyl]thiophene-2-carboxamide (PubChem CID 19505153) has the molecular formula C20H16ClNO3S and a molecular weight of 385.87 g/mol. Its IUPAC name is N-(4-acetylphenyl)-4-[(3-chlorophenoxy)methyl]thiophene-2-carboxamide.
| Compound Name | N-(4-acetylphenyl)-4-[(3-chlorophenoxy)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19505153 |
| Molecular Formula | C20H16ClNO3S |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | N-(4-acetylphenyl)-4-[(3-chlorophenoxy)methyl]thiophene-2-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2cc(COc3cccc(Cl)c3)cs2)cc1 |
| InChI | InChI=1S/C20H16ClNO3S/c1-13(23)15-5-7-17(8-6-15)22-20(24)19-9-14(12-26-19)11-25-18-4-2-3-16(21)10-18/h2-10,12H,11H2,1H3,(H,22,24) |
| InChIKey | HUIWNURHGAEXOD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |