C15H12ClF2N5O — CID 19506848
N-[3-[(4-chloropyrazol-1-yl)methyl]phenyl]-2-(difluoromethyl)pyrazole-3-carboxamide (PubChem CID 19506848) has the molecular formula C15H12ClF2N5O and a molecular weight of 351.74 g/mol. Its IUPAC name is N-[3-[(4-chloropyrazol-1-yl)methyl]phenyl]-2-(difluoromethyl)pyrazole-3-carboxamide.
| Compound Name | N-[3-[(4-chloropyrazol-1-yl)methyl]phenyl]-2-(difluoromethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19506848 |
| Molecular Formula | C15H12ClF2N5O |
| Molecular Weight | 351.74 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | N-[3-[(4-chloropyrazol-1-yl)methyl]phenyl]-2-(difluoromethyl)pyrazole-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cn2cc(Cl)cn2)c1)c1ccnn1C(F)F |
| InChI | InChI=1S/C15H12ClF2N5O/c16-11-7-20-22(9-11)8-10-2-1-3-12(6-10)21-14(24)13-4-5-19-23(13)15(17)18/h1-7,9,15H,8H2,(H,21,24) |
| InChIKey | ILLJQTJIVHDNJB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.74 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |