C21H18ClN5O2 — CID 19508875
N-[1-[(3-chlorophenyl)methyl]pyrazol-3-yl]-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 19508875) has the molecular formula C21H18ClN5O2 and a molecular weight of 407.86 g/mol. Its IUPAC name is N-[1-[(3-chlorophenyl)methyl]pyrazol-3-yl]-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[1-[(3-chlorophenyl)methyl]pyrazol-3-yl]-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19508875 |
| Molecular Formula | C21H18ClN5O2 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-[1-[(3-chlorophenyl)methyl]pyrazol-3-yl]-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)Nc3ccn(Cc4cccc(Cl)c4)n3)[nH]n2)cc1 |
| InChI | InChI=1S/C21H18ClN5O2/c1-29-17-7-5-15(6-8-17)18-12-19(25-24-18)21(28)23-20-9-10-27(26-20)13-14-3-2-4-16(22)11-14/h2-12H,13H2,1H3,(H,24,25)(H,23,26,28) |
| InChIKey | XKFBEPXZZJYTSV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |