C20H19F2N3O4 — CID 19509842
N-[4-(difluoromethoxy)-3-ethoxyphenyl]-3-(3-methoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 19509842) has the molecular formula C20H19F2N3O4 and a molecular weight of 403.39 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)-3-ethoxyphenyl]-3-(3-methoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[4-(difluoromethoxy)-3-ethoxyphenyl]-3-(3-methoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19509842 |
| Molecular Formula | C20H19F2N3O4 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | N-[4-(difluoromethoxy)-3-ethoxyphenyl]-3-(3-methoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | CCOc1cc(NC(=O)c2cc(-c3cccc(OC)c3)n[nH]2)ccc1OC(F)F |
| InChI | InChI=1S/C20H19F2N3O4/c1-3-28-18-10-13(7-8-17(18)29-20(21)22)23-19(26)16-11-15(24-25-16)12-5-4-6-14(9-12)27-2/h4-11,20H,3H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | ITWVSZKAIXZRPB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |