C18H15Cl2N3O2 — CID 19509972
3-(2,4-dichlorophenyl)-N-(4-ethoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 19509972) has the molecular formula C18H15Cl2N3O2 and a molecular weight of 376.24 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-(4-ethoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-(4-ethoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19509972 |
| Molecular Formula | C18H15Cl2N3O2 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-(4-ethoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cc(-c3ccc(Cl)cc3Cl)n[nH]2)cc1 |
| InChI | InChI=1S/C18H15Cl2N3O2/c1-2-25-13-6-4-12(5-7-13)21-18(24)17-10-16(22-23-17)14-8-3-11(19)9-15(14)20/h3-10H,2H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | KUYXENLJSGJOOQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |