C29H43N5O — CID 19511513
N-[1-(dipentylamino)propan-2-yl]-2-(1-ethyl-3-methylpyrazol-4-yl)quinoline-4-carboxamide (PubChem CID 19511513) has the molecular formula C29H43N5O and a molecular weight of 477.70 g/mol. Its IUPAC name is N-[1-(dipentylamino)propan-2-yl]-2-(1-ethyl-3-methylpyrazol-4-yl)quinoline-4-carboxamide.
| Compound Name | N-[1-(dipentylamino)propan-2-yl]-2-(1-ethyl-3-methylpyrazol-4-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 19511513 |
| Molecular Formula | C29H43N5O |
| Molecular Weight | 477.70 g/mol |
| Exact Mass | 477.35 |
| IUPAC Name | N-[1-(dipentylamino)propan-2-yl]-2-(1-ethyl-3-methylpyrazol-4-yl)quinoline-4-carboxamide |
| SMILES | CCCCCN(CCCCC)CC(C)NC(=O)c1cc(-c2cn(CC)nc2C)nc2ccccc12 |
| InChI | InChI=1S/C29H43N5O/c1-6-9-13-17-33(18-14-10-7-2)20-22(4)30-29(35)25-19-28(26-21-34(8-3)32-23(26)5)31-27-16-12-11-15-24(25)27/h11-12,15-16,19,21-22H,6-10,13-14,17-18,20H2,1-5H3,(H,30,35) |
| InChIKey | IUAIEYXAHNCWKI-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.70 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|