C26H20F4N6O — CID 19512139
2-(1-ethyl-5-methylpyrazol-4-yl)-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]quinoline-4-carboxamide (PubChem CID 19512139) has the molecular formula C26H20F4N6O and a molecular weight of 508.48 g/mol. Its IUPAC name is 2-(1-ethyl-5-methylpyrazol-4-yl)-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]quinoline-4-carboxamide.
| Compound Name | 2-(1-ethyl-5-methylpyrazol-4-yl)-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 19512139 |
| Molecular Formula | C26H20F4N6O |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | 2-(1-ethyl-5-methylpyrazol-4-yl)-N-[1-[(2,3,4,6-tetrafluorophenyl)methyl]pyrazol-4-yl]quinoline-4-carboxamide |
| SMILES | CCn1ncc(-c2cc(C(=O)Nc3cnn(Cc4c(F)cc(F)c(F)c4F)c3)c3ccccc3n2)c1C |
| InChI | InChI=1S/C26H20F4N6O/c1-3-36-14(2)18(11-32-36)23-8-17(16-6-4-5-7-22(16)34-23)26(37)33-15-10-31-35(12-15)13-19-20(27)9-21(28)25(30)24(19)29/h4-12H,3,13H2,1-2H3,(H,33,37) |
| InChIKey | YBEOWSLYRUDHTG-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|