C13H18N6O4 — CID 19515315
3-methoxy-N-methyl-4-nitro-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1H-pyrazole-5-carboxamide (PubChem CID 19515315) has the molecular formula C13H18N6O4 and a molecular weight of 322.33 g/mol. Its IUPAC name is 3-methoxy-N-methyl-4-nitro-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-methoxy-N-methyl-4-nitro-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19515315 |
| Molecular Formula | C13H18N6O4 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 3-methoxy-N-methyl-4-nitro-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]-1H-pyrazole-5-carboxamide |
| SMILES | COc1n[nH]c(C(=O)N(C)Cc2c(C)nn(C)c2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18N6O4/c1-7-9(8(2)18(4)16-7)6-17(3)13(20)10-11(19(21)22)12(23-5)15-14-10/h6H2,1-5H3,(H,14,15) |
| InChIKey | QNVWWSSQTLYEMC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 119.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|