C13H15F3N6O4 — CID 19515876
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]acetamide (PubChem CID 19515876) has the molecular formula C13H15F3N6O4 and a molecular weight of 376.30 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]acetamide.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 19515876 |
| Molecular Formula | C13H15F3N6O4 |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]acetamide |
| SMILES | Cc1nn(CC(=O)Nc2cnn(COCC(F)(F)F)c2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15F3N6O4/c1-8-12(22(24)25)9(2)21(19-8)5-11(23)18-10-3-17-20(4-10)7-26-6-13(14,15)16/h3-4H,5-7H2,1-2H3,(H,18,23) |
| InChIKey | VSTCUHYRUXXCNR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|