C11H17F2N3O — CID 19516578
N-butan-2-yl-2-[5-(difluoromethyl)-3-methylpyrazol-1-yl]acetamide (PubChem CID 19516578) has the molecular formula C11H17F2N3O and a molecular weight of 245.27 g/mol. Its IUPAC name is N-butan-2-yl-2-[5-(difluoromethyl)-3-methylpyrazol-1-yl]acetamide.
| Compound Name | N-butan-2-yl-2-[5-(difluoromethyl)-3-methylpyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 19516578 |
| Molecular Formula | C11H17F2N3O |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | N-butan-2-yl-2-[5-(difluoromethyl)-3-methylpyrazol-1-yl]acetamide |
| SMILES | CCC(C)NC(=O)Cn1nc(C)cc1C(F)F |
| InChI | InChI=1S/C11H17F2N3O/c1-4-7(2)14-10(17)6-16-9(11(12)13)5-8(3)15-16/h5,7,11H,4,6H2,1-3H3,(H,14,17) |
| InChIKey | JFLFWENOKBANHM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |